C11H21N3O — CID 105148342
1-(2-ethylpyrazol-3-yl)-3-propoxypropan-1-amine (PubChem CID 105148342) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(2-ethylpyrazol-3-yl)-3-propoxypropan-1-amine.
| Compound Name | 1-(2-ethylpyrazol-3-yl)-3-propoxypropan-1-amine |
|---|---|
| PubChem CID | 105148342 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-(2-ethylpyrazol-3-yl)-3-propoxypropan-1-amine |
| SMILES | CCCOCCC(N)c1ccnn1CC |
| InChI | InChI=1S/C11H21N3O/c1-3-8-15-9-6-10(12)11-5-7-13-14(11)4-2/h5,7,10H,3-4,6,8-9,12H2,1-2H3 |
| InChIKey | RVWDRILYQZDAKB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|