C12H21N3S — CID 105148565
N-[(2-methylpyrazol-3-yl)-(2-methylthiolan-2-yl)methyl]ethanamine (PubChem CID 105148565) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is N-[(2-methylpyrazol-3-yl)-(2-methylthiolan-2-yl)methyl]ethanamine.
| Compound Name | N-[(2-methylpyrazol-3-yl)-(2-methylthiolan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105148565 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-[(2-methylpyrazol-3-yl)-(2-methylthiolan-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccnn1C)C1(C)CCCS1 |
| InChI | InChI=1S/C12H21N3S/c1-4-13-11(10-6-8-14-15(10)3)12(2)7-5-9-16-12/h6,8,11,13H,4-5,7,9H2,1-3H3 |
| InChIKey | GZTHAMRYKIVTLU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |