C15H16N2 — CID 105148985
N-methyl-1-quinolin-8-ylpent-4-yn-1-amine (PubChem CID 105148985) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is N-methyl-1-quinolin-8-ylpent-4-yn-1-amine.
| Compound Name | N-methyl-1-quinolin-8-ylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 105148985 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-methyl-1-quinolin-8-ylpent-4-yn-1-amine |
| SMILES | C#CCCC(NC)c1cccc2cccnc12 |
| InChI | InChI=1S/C15H16N2/c1-3-4-10-14(16-2)13-9-5-7-12-8-6-11-17-15(12)13/h1,5-9,11,14,16H,4,10H2,2H3 |
| InChIKey | TYZKMSWHSJWOLI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|