C14H23N3 — CID 105149069
1-(1,3-diethylpyrazol-5-yl)-N-ethylpent-4-yn-1-amine (PubChem CID 105149069) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-(1,3-diethylpyrazol-5-yl)-N-ethylpent-4-yn-1-amine.
| Compound Name | 1-(1,3-diethylpyrazol-5-yl)-N-ethylpent-4-yn-1-amine |
|---|---|
| PubChem CID | 105149069 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 1-(1,3-diethylpyrazol-5-yl)-N-ethylpent-4-yn-1-amine |
| SMILES | C#CCCC(NCC)c1cc(CC)nn1CC |
| InChI | InChI=1S/C14H23N3/c1-5-9-10-13(15-7-3)14-11-12(6-2)16-17(14)8-4/h1,11,13,15H,6-10H2,2-4H3 |
| InChIKey | IIXGNKAMFKBDKT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|