About 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine
1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine (PubChem CID 105150095) has the molecular formula C12H17F2N3
and a molecular weight of 241.28 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine.
Molecular Properties
| Compound Name | 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine |
| PubChem CID | 105150095 |
| Molecular Formula | C12H17F2N3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine |
| SMILES | CNC(c1cnccn1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H17F2N3/c1-15-11(10-8-16-6-7-17-10)9-2-4-12(13,14)5-3-9/h6-9,11,15H,2-5H2,1H3 |
| InChIKey | FGDPWELVCIBXLX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine?
The IUPAC name of 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine (CID 105150095) is 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine.
What is the SMILES notation for 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine?
The canonical SMILES for 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine is CNC(c1cnccn1)C1CCC(F)(F)CC1.
What is the InChIKey of 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine?
The InChIKey is FGDPWELVCIBXLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3/c1-15-11(10-8-16-6-7-17-10)9-2-4-12(13,14)5-3-9/h6-9,11,15H,2-5H2,1H3.
What are the key properties of 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine?
1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine has a molecular weight of 241.28 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorocyclohexyl)-N-methyl-1-pyrazin-2-ylmethanamine is sourced from PubChem (CID 105150095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).