C12H20BrNO2 — CID 105150455
1-(3-bromofuran-2-yl)-3-ethoxy-N-propylpropan-1-amine (PubChem CID 105150455) has the molecular formula C12H20BrNO2 and a molecular weight of 290.20 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-3-ethoxy-N-propylpropan-1-amine.
| Compound Name | 1-(3-bromofuran-2-yl)-3-ethoxy-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 105150455 |
| Molecular Formula | C12H20BrNO2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-3-ethoxy-N-propylpropan-1-amine |
| SMILES | CCCNC(CCOCC)c1occc1Br |
| InChI | InChI=1S/C12H20BrNO2/c1-3-7-14-11(6-8-15-4-2)12-10(13)5-9-16-12/h5,9,11,14H,3-4,6-8H2,1-2H3 |
| InChIKey | BSUTXJOGUIUXAC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|