C17H19NO — CID 10515048
N-(1,2-dihydroacenaphthylen-1-ylmethyl)butanamide (PubChem CID 10515048) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is N-(1,2-dihydroacenaphthylen-1-ylmethyl)butanamide.
| Compound Name | N-(1,2-dihydroacenaphthylen-1-ylmethyl)butanamide |
|---|---|
| PubChem CID | 10515048 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-1-ylmethyl)butanamide |
| SMILES | CCCC(=O)NCC1Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C17H19NO/c1-2-5-16(19)18-11-14-10-13-8-3-6-12-7-4-9-15(14)17(12)13/h3-4,6-9,14H,2,5,10-11H2,1H3,(H,18,19) |
| InChIKey | RBHKOXOMHRAMGH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |