About 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol
3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 10515074) has the molecular formula C9H9F3O3S
and a molecular weight of 254.23 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 10515074 |
| Molecular Formula | C9H9F3O3S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | O=S(=O)(CC(O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C9H9F3O3S/c10-9(11,12)8(13)6-16(14,15)7-4-2-1-3-5-7/h1-5,8,13H,6H2 |
| InChIKey | ZTBOGMMAFHQXIG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol (CID 10515074) is 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol is O=S(=O)(CC(O)C(F)(F)F)c1ccccc1.
What is the InChIKey of 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol?
The InChIKey is ZTBOGMMAFHQXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3O3S/c10-9(11,12)8(13)6-16(14,15)7-4-2-1-3-5-7/h1-5,8,13H,6H2.
What are the key properties of 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol?
3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol has a molecular weight of 254.23 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 10515074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).