C13H21NO4 — CID 10515172
tert-butyl [(2R,3Z)-8-oxo-2,5,6,7-tetrahydro-1H-azocin-2-yl]methyl carbonate (PubChem CID 10515172) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is tert-butyl [(2R,3Z)-8-oxo-2,5,6,7-tetrahydro-1H-azocin-2-yl]methyl carbonate.
| Compound Name | tert-butyl [(2R,3Z)-8-oxo-2,5,6,7-tetrahydro-1H-azocin-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 10515172 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | tert-butyl [(2R,3Z)-8-oxo-2,5,6,7-tetrahydro-1H-azocin-2-yl]methyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC[C@H]1/C=C\CCCC(=O)N1 |
| InChI | InChI=1S/C13H21NO4/c1-13(2,3)18-12(16)17-9-10-7-5-4-6-8-11(15)14-10/h5,7,10H,4,6,8-9H2,1-3H3,(H,14,15)/b7-5-/t10-/m1/s1 |
| InChIKey | XUXBZYBFYIVROF-ONRRBMGISA-N |
| XLogP | 2.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|