About ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate
ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate (PubChem CID 10515224) has the molecular formula C13H20O5
and a molecular weight of 256.30 g/mol. Its IUPAC name is ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate.
Molecular Properties
| Compound Name | ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate |
| PubChem CID | 10515224 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H](OCC)C[C@]2(CCCO2)O1 |
| InChI | InChI=1S/C13H20O5/c1-3-15-10-8-11(12(14)16-4-2)18-13(9-10)6-5-7-17-13/h8,10H,3-7,9H2,1-2H3/t10-,13-/m0/s1 |
| InChIKey | JIMJFIBSQQLUGE-GWCFXTLKSA-N |
| XLogP | 1.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate?
The IUPAC name of ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate (CID 10515224) is ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate.
What is the SMILES notation for ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate?
The canonical SMILES for ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate is CCOC(=O)C1=C[C@H](OCC)C[C@]2(CCCO2)O1.
What is the InChIKey of ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate?
The InChIKey is JIMJFIBSQQLUGE-GWCFXTLKSA-N. The full InChI is InChI=1S/C13H20O5/c1-3-15-10-8-11(12(14)16-4-2)18-13(9-10)6-5-7-17-13/h8,10H,3-7,9H2,1-2H3/t10-,13-/m0/s1.
What are the key properties of ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate?
ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate has a molecular weight of 256.30 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (5S,9R)-9-ethoxy-1,6-dioxaspiro[4.5]dec-7-ene-7-carboxylate is sourced from PubChem (CID 10515224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).