About 2-methylsulfanyl-1,3-diphenylpropan-1-one
2-methylsulfanyl-1,3-diphenylpropan-1-one (PubChem CID 10515251) has the molecular formula C16H16OS
and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-methylsulfanyl-1,3-diphenylpropan-1-one.
Molecular Properties
| Compound Name | 2-methylsulfanyl-1,3-diphenylpropan-1-one |
| PubChem CID | 10515251 |
| Molecular Formula | C16H16OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-methylsulfanyl-1,3-diphenylpropan-1-one |
| SMILES | CSC(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16OS/c1-18-15(12-13-8-4-2-5-9-13)16(17)14-10-6-3-7-11-14/h2-11,15H,12H2,1H3 |
| InChIKey | NAYDIWTVZJELDZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylsulfanyl-1,3-diphenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-1,3-diphenylpropan-1-one?
The IUPAC name of 2-methylsulfanyl-1,3-diphenylpropan-1-one (CID 10515251) is 2-methylsulfanyl-1,3-diphenylpropan-1-one.
What is the SMILES notation for 2-methylsulfanyl-1,3-diphenylpropan-1-one?
The canonical SMILES for 2-methylsulfanyl-1,3-diphenylpropan-1-one is CSC(Cc1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of 2-methylsulfanyl-1,3-diphenylpropan-1-one?
The InChIKey is NAYDIWTVZJELDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16OS/c1-18-15(12-13-8-4-2-5-9-13)16(17)14-10-6-3-7-11-14/h2-11,15H,12H2,1H3.
What are the key properties of 2-methylsulfanyl-1,3-diphenylpropan-1-one?
2-methylsulfanyl-1,3-diphenylpropan-1-one has a molecular weight of 256.37 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-1,3-diphenylpropan-1-one is sourced from PubChem (CID 10515251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).