About 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine
1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine (PubChem CID 105152564) has the molecular formula C14H27F2NO2S
and a molecular weight of 311.44 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine |
| PubChem CID | 105152564 |
| Molecular Formula | C14H27F2NO2S |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine |
| SMILES | CCNC(CCCS(=O)(=O)CC)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H27F2NO2S/c1-3-17-13(6-5-11-20(18,19)4-2)12-7-9-14(15,16)10-8-12/h12-13,17H,3-11H2,1-2H3 |
| InChIKey | WHNQDAWYMQEHEB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine?
The IUPAC name of 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine (CID 105152564) is 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine.
What is the SMILES notation for 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine?
The canonical SMILES for 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine is CCNC(CCCS(=O)(=O)CC)C1CCC(F)(F)CC1.
What is the InChIKey of 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine?
The InChIKey is WHNQDAWYMQEHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27F2NO2S/c1-3-17-13(6-5-11-20(18,19)4-2)12-7-9-14(15,16)10-8-12/h12-13,17H,3-11H2,1-2H3.
What are the key properties of 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine?
1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine has a molecular weight of 311.44 g/mol, XLogP of 3.00, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorocyclohexyl)-N-ethyl-4-ethylsulfonylbutan-1-amine is sourced from PubChem (CID 105152564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).