C15H21NS — CID 105152995
1-(2,3-dihydro-1-benzothiophen-3-yl)-N-methylhex-5-en-1-amine (PubChem CID 105152995) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-3-yl)-N-methylhex-5-en-1-amine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)-N-methylhex-5-en-1-amine |
|---|---|
| PubChem CID | 105152995 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)-N-methylhex-5-en-1-amine |
| SMILES | C=CCCCC(NC)C1CSc2ccccc21 |
| InChI | InChI=1S/C15H21NS/c1-3-4-5-9-14(16-2)13-11-17-15-10-7-6-8-12(13)15/h3,6-8,10,13-14,16H,1,4-5,9,11H2,2H3 |
| InChIKey | CZSUSDDNFMIYHW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|