About 1-ethoxynon-8-en-4-amine
1-ethoxynon-8-en-4-amine (PubChem CID 105153203) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-ethoxynon-8-en-4-amine.
Molecular Properties
| Compound Name | 1-ethoxynon-8-en-4-amine |
| PubChem CID | 105153203 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 1-ethoxynon-8-en-4-amine |
| SMILES | C=CCCCC(N)CCCOCC |
| InChI | InChI=1S/C11H23NO/c1-3-5-6-8-11(12)9-7-10-13-4-2/h3,11H,1,4-10,12H2,2H3 |
| InChIKey | MLHCYEDAKDQFNV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxynon-8-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxynon-8-en-4-amine?
The IUPAC name of 1-ethoxynon-8-en-4-amine (CID 105153203) is 1-ethoxynon-8-en-4-amine.
What is the SMILES notation for 1-ethoxynon-8-en-4-amine?
The canonical SMILES for 1-ethoxynon-8-en-4-amine is C=CCCCC(N)CCCOCC.
What is the InChIKey of 1-ethoxynon-8-en-4-amine?
The InChIKey is MLHCYEDAKDQFNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-3-5-6-8-11(12)9-7-10-13-4-2/h3,11H,1,4-10,12H2,2H3.
What are the key properties of 1-ethoxynon-8-en-4-amine?
1-ethoxynon-8-en-4-amine has a molecular weight of 185.31 g/mol, XLogP of 2.49, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxynon-8-en-4-amine is sourced from PubChem (CID 105153203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).