C18H24N2 — CID 105154267
(3,5-dimethylcyclohexyl)-quinolin-8-ylmethanamine (PubChem CID 105154267) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)-quinolin-8-ylmethanamine.
| Compound Name | (3,5-dimethylcyclohexyl)-quinolin-8-ylmethanamine |
|---|---|
| PubChem CID | 105154267 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (3,5-dimethylcyclohexyl)-quinolin-8-ylmethanamine |
| SMILES | CC1CC(C)CC(C(N)c2cccc3cccnc23)C1 |
| InChI | InChI=1S/C18H24N2/c1-12-9-13(2)11-15(10-12)17(19)16-7-3-5-14-6-4-8-20-18(14)16/h3-8,12-13,15,17H,9-11,19H2,1-2H3 |
| InChIKey | VVIWWIZZCLHWQO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |