About N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine
N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine (PubChem CID 105154530) has the molecular formula C18H33F2N
and a molecular weight of 301.46 g/mol. Its IUPAC name is N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine |
| PubChem CID | 105154530 |
| Molecular Formula | C18H33F2N |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1CCC(F)(F)CC1)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C18H33F2N/c1-4-11-21-17(15-7-9-18(19,20)10-8-15)16-6-5-13(2)14(3)12-16/h13-17,21H,4-12H2,1-3H3 |
| InChIKey | CNVDXEOPJHUZPJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
The IUPAC name of N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine (CID 105154530) is N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine.
What is the SMILES notation for N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
The canonical SMILES for N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine is CCCNC(C1CCC(F)(F)CC1)C1CCC(C)C(C)C1.
What is the InChIKey of N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
The InChIKey is CNVDXEOPJHUZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33F2N/c1-4-11-21-17(15-7-9-18(19,20)10-8-15)16-6-5-13(2)14(3)12-16/h13-17,21H,4-12H2,1-3H3.
What are the key properties of N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine has a molecular weight of 301.46 g/mol, XLogP of 5.25, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,4-difluorocyclohexyl)-(3,4-dimethylcyclohexyl)methyl]propan-1-amine is sourced from PubChem (CID 105154530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).