C13H15F3O2 — CID 10515474
(1R,6S,8aR)-1-ethynyl-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydronaphthalene-1,6-diol (PubChem CID 10515474) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is (1R,6S,8aR)-1-ethynyl-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydronaphthalene-1,6-diol.
| Compound Name | (1R,6S,8aR)-1-ethynyl-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydronaphthalene-1,6-diol |
|---|---|
| PubChem CID | 10515474 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (1R,6S,8aR)-1-ethynyl-8a-(trifluoromethyl)-2,3,4,6,7,8-hexahydronaphthalene-1,6-diol |
| SMILES | C#C[C@]1(O)CCCC2=C[C@@H](O)CC[C@@]21C(F)(F)F |
| InChI | InChI=1S/C13H15F3O2/c1-2-11(18)6-3-4-9-8-10(17)5-7-12(9,11)13(14,15)16/h1,8,10,17-18H,3-7H2/t10-,11-,12+/m0/s1 |
| InChIKey | BUQXSOWPDYHACZ-SDDRHHMPSA-N |
| XLogP | 2.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|