C12H23N3O — CID 105154955
4-ethoxy-1-(1-propan-2-ylpyrazol-3-yl)butan-2-amine (PubChem CID 105154955) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-ethoxy-1-(1-propan-2-ylpyrazol-3-yl)butan-2-amine.
| Compound Name | 4-ethoxy-1-(1-propan-2-ylpyrazol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 105154955 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 4-ethoxy-1-(1-propan-2-ylpyrazol-3-yl)butan-2-amine |
| SMILES | CCOCCC(N)Cc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C12H23N3O/c1-4-16-8-6-11(13)9-12-5-7-15(14-12)10(2)3/h5,7,10-11H,4,6,8-9,13H2,1-3H3 |
| InChIKey | ALZBPLDQIQFMAT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|