C15H22F3NS — CID 105155633
N-[(5-methylthiophen-3-yl)-[3-(trifluoromethyl)cyclohexyl]methyl]ethanamine (PubChem CID 105155633) has the molecular formula C15H22F3NS and a molecular weight of 305.41 g/mol. Its IUPAC name is N-[(5-methylthiophen-3-yl)-[3-(trifluoromethyl)cyclohexyl]methyl]ethanamine.
| Compound Name | N-[(5-methylthiophen-3-yl)-[3-(trifluoromethyl)cyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 105155633 |
| Molecular Formula | C15H22F3NS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[(5-methylthiophen-3-yl)-[3-(trifluoromethyl)cyclohexyl]methyl]ethanamine |
| SMILES | CCNC(c1csc(C)c1)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H22F3NS/c1-3-19-14(12-7-10(2)20-9-12)11-5-4-6-13(8-11)15(16,17)18/h7,9,11,13-14,19H,3-6,8H2,1-2H3 |
| InChIKey | BLYJWJQDFCEKDA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |