About (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane
(2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane (PubChem CID 10515586) has the molecular formula C6H9F2IO
and a molecular weight of 262.04 g/mol. Its IUPAC name is (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane.
Molecular Properties
| Compound Name | (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane |
| PubChem CID | 10515586 |
| Molecular Formula | C6H9F2IO |
| Molecular Weight | 262.04 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane |
| SMILES | C[C@H]1O[C@H](CI)CC1(F)F |
| InChI | InChI=1S/C6H9F2IO/c1-4-6(7,8)2-5(3-9)10-4/h4-5H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | ODSIUXKHMARSHW-UHNVWZDZSA-N |
| XLogP | 2.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.04 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane?
The IUPAC name of (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane (CID 10515586) is (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane.
What is the SMILES notation for (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane?
The canonical SMILES for (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane is C[C@H]1O[C@H](CI)CC1(F)F.
What is the InChIKey of (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane?
The InChIKey is ODSIUXKHMARSHW-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H9F2IO/c1-4-6(7,8)2-5(3-9)10-4/h4-5H,2-3H2,1H3/t4-,5+/m1/s1.
What are the key properties of (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane?
(2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane has a molecular weight of 262.04 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-3,3-difluoro-5-(iodomethyl)-2-methyloxolane is sourced from PubChem (CID 10515586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).