C16H22O3 — CID 10515628
methyl (1S,4R,5S,8S)-4-ethyl-3-methylidene-11-oxotricyclo[6.2.1.01,5]undecane-8-carboxylate (PubChem CID 10515628) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (1S,4R,5S,8S)-4-ethyl-3-methylidene-11-oxotricyclo[6.2.1.01,5]undecane-8-carboxylate.
| Compound Name | methyl (1S,4R,5S,8S)-4-ethyl-3-methylidene-11-oxotricyclo[6.2.1.01,5]undecane-8-carboxylate |
|---|---|
| PubChem CID | 10515628 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (1S,4R,5S,8S)-4-ethyl-3-methylidene-11-oxotricyclo[6.2.1.01,5]undecane-8-carboxylate |
| SMILES | C=C1C[C@@]23CC[C@@](C(=O)OC)(CC[C@H]2[C@H]1CC)C3=O |
| InChI | InChI=1S/C16H22O3/c1-4-11-10(2)9-16-8-7-15(13(16)17,14(18)19-3)6-5-12(11)16/h11-12H,2,4-9H2,1,3H3/t11-,12-,15-,16-/m0/s1 |
| InChIKey | BWIJJIZTDOKVJG-APYUEPQZSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|