C17H26O2 — CID 10515640
(1R,5S,6R,8S,12R)-12-butyl-5-hydroxy-7-methylidenetricyclo[6.3.1.01,6]dodecan-11-one (PubChem CID 10515640) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (1R,5S,6R,8S,12R)-12-butyl-5-hydroxy-7-methylidenetricyclo[6.3.1.01,6]dodecan-11-one.
| Compound Name | (1R,5S,6R,8S,12R)-12-butyl-5-hydroxy-7-methylidenetricyclo[6.3.1.01,6]dodecan-11-one |
|---|---|
| PubChem CID | 10515640 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (1R,5S,6R,8S,12R)-12-butyl-5-hydroxy-7-methylidenetricyclo[6.3.1.01,6]dodecan-11-one |
| SMILES | C=C1[C@H]2CCC(=O)[C@]3(CCC[C@H](O)[C@H]13)[C@@H]2CCCC |
| InChI | InChI=1S/C17H26O2/c1-3-4-6-13-12-8-9-15(19)17(13)10-5-7-14(18)16(17)11(12)2/h12-14,16,18H,2-10H2,1H3/t12-,13-,14+,16+,17+/m1/s1 |
| InChIKey | GQNIGORQBXZDKJ-BJMQQELFSA-N |
| XLogP | 3.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|