C16H26N2O — CID 105156934
N-ethyl-1-(oxolan-2-yl)-5-pyridin-2-ylpentan-3-amine (PubChem CID 105156934) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is N-ethyl-1-(oxolan-2-yl)-5-pyridin-2-ylpentan-3-amine.
| Compound Name | N-ethyl-1-(oxolan-2-yl)-5-pyridin-2-ylpentan-3-amine |
|---|---|
| PubChem CID | 105156934 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | N-ethyl-1-(oxolan-2-yl)-5-pyridin-2-ylpentan-3-amine |
| SMILES | CCNC(CCc1ccccn1)CCC1CCCO1 |
| InChI | InChI=1S/C16H26N2O/c1-2-17-15(10-11-16-7-5-13-19-16)9-8-14-6-3-4-12-18-14/h3-4,6,12,15-17H,2,5,7-11,13H2,1H3 |
| InChIKey | CCAFNRGIKCWFTJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |