C13H21ClN2O — CID 105157358
1-(3-chloro-4-pyridinyl)-5-ethoxy-N-methylpentan-2-amine (PubChem CID 105157358) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-5-ethoxy-N-methylpentan-2-amine.
| Compound Name | 1-(3-chloro-4-pyridinyl)-5-ethoxy-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 105157358 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-5-ethoxy-N-methylpentan-2-amine |
| SMILES | CCOCCCC(Cc1ccncc1Cl)NC |
| InChI | InChI=1S/C13H21ClN2O/c1-3-17-8-4-5-12(15-2)9-11-6-7-16-10-13(11)14/h6-7,10,12,15H,3-5,8-9H2,1-2H3 |
| InChIKey | YWGPSGZMJTYZBM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|