About 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole
9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole (PubChem CID 10515775) has the molecular formula C12H12N2OS2
and a molecular weight of 264.38 g/mol. Its IUPAC name is 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole.
Molecular Properties
| Compound Name | 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole |
| PubChem CID | 10515775 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole |
| SMILES | COn1c2c(c3ccccc31)CN=C(SC)S2 |
| InChI | InChI=1S/C12H12N2OS2/c1-15-14-10-6-4-3-5-8(10)9-7-13-12(16-2)17-11(9)14/h3-6H,7H2,1-2H3 |
| InChIKey | JCYHQSOLTRRNNC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole?
The IUPAC name of 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole (CID 10515775) is 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole.
What is the SMILES notation for 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole?
The canonical SMILES for 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole is COn1c2c(c3ccccc31)CN=C(SC)S2.
What is the InChIKey of 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole?
The InChIKey is JCYHQSOLTRRNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2OS2/c1-15-14-10-6-4-3-5-8(10)9-7-13-12(16-2)17-11(9)14/h3-6H,7H2,1-2H3.
What are the key properties of 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole?
9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole has a molecular weight of 264.38 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-2-methylsulfanyl-4H-[1,3]thiazino[6,5-b]indole is sourced from PubChem (CID 10515775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).