C14H18O5 — CID 10515874
(1S,2R,4R,8S)-2,4-dimethoxy-3-oxo-8-propanoylbicyclo[2.2.2]oct-5-ene-2-carbaldehyde (PubChem CID 10515874) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (1S,2R,4R,8S)-2,4-dimethoxy-3-oxo-8-propanoylbicyclo[2.2.2]oct-5-ene-2-carbaldehyde.
| Compound Name | (1S,2R,4R,8S)-2,4-dimethoxy-3-oxo-8-propanoylbicyclo[2.2.2]oct-5-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 10515874 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1S,2R,4R,8S)-2,4-dimethoxy-3-oxo-8-propanoylbicyclo[2.2.2]oct-5-ene-2-carbaldehyde |
| SMILES | CCC(=O)[C@H]1C[C@H]2C=C[C@]1(OC)C(=O)[C@@]2(C=O)OC |
| InChI | InChI=1S/C14H18O5/c1-4-11(16)10-7-9-5-6-13(10,18-2)12(17)14(9,8-15)19-3/h5-6,8-10H,4,7H2,1-3H3/t9-,10-,13-,14+/m1/s1 |
| InChIKey | KBIOEGIFKHZHTJ-MHWZDGSBSA-N |
| XLogP | 0.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|