About 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine
2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine (PubChem CID 105159076) has the molecular formula C13H19F3N2S
and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine.
Molecular Properties
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine |
| PubChem CID | 105159076 |
| Molecular Formula | C13H19F3N2S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine |
| SMILES | Cc1nc(CC(N)C2CCCCC2C(F)(F)F)cs1 |
| InChI | InChI=1S/C13H19F3N2S/c1-8-18-9(7-19-8)6-12(17)10-4-2-3-5-11(10)13(14,15)16/h7,10-12H,2-6,17H2,1H3 |
| InChIKey | VWHMVNJWVUNLGL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine?
The IUPAC name of 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine (CID 105159076) is 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine.
What is the SMILES notation for 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine?
The canonical SMILES for 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine is Cc1nc(CC(N)C2CCCCC2C(F)(F)F)cs1.
What is the InChIKey of 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine?
The InChIKey is VWHMVNJWVUNLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N2S/c1-8-18-9(7-19-8)6-12(17)10-4-2-3-5-11(10)13(14,15)16/h7,10-12H,2-6,17H2,1H3.
What are the key properties of 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine?
2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine has a molecular weight of 292.37 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-thiazol-4-yl)-1-[2-(trifluoromethyl)cyclohexyl]ethanamine is sourced from PubChem (CID 105159076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).