About 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol
6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol (PubChem CID 10515910) has the molecular formula C14H18O3S
and a molecular weight of 266.36 g/mol. Its IUPAC name is 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol.
Molecular Properties
| Compound Name | 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol |
| PubChem CID | 10515910 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol |
| SMILES | CS(=O)c1cc2c(cc1O)COC21CCCCC1 |
| InChI | InChI=1S/C14H18O3S/c1-18(16)13-8-11-10(7-12(13)15)9-17-14(11)5-3-2-4-6-14/h7-8,15H,2-6,9H2,1H3 |
| InChIKey | ZNXKMEGWAFBWAM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol?
The IUPAC name of 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol (CID 10515910) is 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol.
What is the SMILES notation for 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol?
The canonical SMILES for 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol is CS(=O)c1cc2c(cc1O)COC21CCCCC1.
What is the InChIKey of 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol?
The InChIKey is ZNXKMEGWAFBWAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3S/c1-18(16)13-8-11-10(7-12(13)15)9-17-14(11)5-3-2-4-6-14/h7-8,15H,2-6,9H2,1H3.
What are the key properties of 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol?
6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol has a molecular weight of 266.36 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfinylspiro[3H-2-benzofuran-1,1'-cyclohexane]-5-ol is sourced from PubChem (CID 10515910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).