C18H34O — CID 10515929
(5E,7E)-14-[(2-methylpropan-2-yl)oxy]tetradeca-5,7-diene (PubChem CID 10515929) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is (5E,7E)-14-[(2-methylpropan-2-yl)oxy]tetradeca-5,7-diene.
| Compound Name | (5E,7E)-14-[(2-methylpropan-2-yl)oxy]tetradeca-5,7-diene |
|---|---|
| PubChem CID | 10515929 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | (5E,7E)-14-[(2-methylpropan-2-yl)oxy]tetradeca-5,7-diene |
| SMILES | CCCC/C=C/C=C/CCCCCCOC(C)(C)C |
| InChI | InChI=1S/C18H34O/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-19-18(2,3)4/h8-11H,5-7,12-17H2,1-4H3/b9-8+,11-10+ |
| InChIKey | QPUJALVAZPRTKY-BNFZFUHLSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|