C13H20ClN5 — CID 105159919
2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-methyl-1-(2-methylpyrazol-3-yl)ethanamine (PubChem CID 105159919) has the molecular formula C13H20ClN5 and a molecular weight of 281.79 g/mol. Its IUPAC name is 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-methyl-1-(2-methylpyrazol-3-yl)ethanamine.
| Compound Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-methyl-1-(2-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 105159919 |
| Molecular Formula | C13H20ClN5 |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-methyl-1-(2-methylpyrazol-3-yl)ethanamine |
| SMILES | CCc1nn(C)c(CC(NC)c2ccnn2C)c1Cl |
| InChI | InChI=1S/C13H20ClN5/c1-5-9-13(14)12(19(4)17-9)8-10(15-2)11-6-7-16-18(11)3/h6-7,10,15H,5,8H2,1-4H3 |
| InChIKey | CCXMYDKSIKFYDT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |