C12H13NO2S2 — CID 10515994
4-[(2S,4R,5S)-4,5-dihydroxythian-2-yl]sulfanylbenzonitrile (PubChem CID 10515994) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-[(2S,4R,5S)-4,5-dihydroxythian-2-yl]sulfanylbenzonitrile.
| Compound Name | 4-[(2S,4R,5S)-4,5-dihydroxythian-2-yl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 10515994 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 4-[(2S,4R,5S)-4,5-dihydroxythian-2-yl]sulfanylbenzonitrile |
| SMILES | N#Cc1ccc(S[C@H]2C[C@@H](O)[C@H](O)CS2)cc1 |
| InChI | InChI=1S/C12H13NO2S2/c13-6-8-1-3-9(4-2-8)17-12-5-10(14)11(15)7-16-12/h1-4,10-12,14-15H,5,7H2/t10-,11-,12+/m1/s1 |
| InChIKey | JTKPXHLNMTUEAM-UTUOFQBUSA-N |
| XLogP | 1.84 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |