C15H28O2Si — CID 10516078
trimethyl-[[(2S,5R)-2,6,6-trimethyl-1-oxaspiro[4.5]dec-9-en-10-yl]oxy]silane (PubChem CID 10516078) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is trimethyl-[[(2S,5R)-2,6,6-trimethyl-1-oxaspiro[4.5]dec-9-en-10-yl]oxy]silane.
| Compound Name | trimethyl-[[(2S,5R)-2,6,6-trimethyl-1-oxaspiro[4.5]dec-9-en-10-yl]oxy]silane |
|---|---|
| PubChem CID | 10516078 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | trimethyl-[[(2S,5R)-2,6,6-trimethyl-1-oxaspiro[4.5]dec-9-en-10-yl]oxy]silane |
| SMILES | C[C@H]1CC[C@]2(O1)C(O[Si](C)(C)C)=CCCC2(C)C |
| InChI | InChI=1S/C15H28O2Si/c1-12-9-11-15(16-12)13(17-18(4,5)6)8-7-10-14(15,2)3/h8,12H,7,9-11H2,1-6H3/t12-,15-/m0/s1 |
| InChIKey | AKTUYGABOKTBKJ-WFASDCNBSA-N |
| XLogP | 4.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|