C9H14N2S — CID 105161160
N-ethyl-1-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-amine (PubChem CID 105161160) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is N-ethyl-1-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-amine.
| Compound Name | N-ethyl-1-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 105161160 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | N-ethyl-1-(2-methyl-1,3-thiazol-4-yl)prop-2-en-1-amine |
| SMILES | C=CC(NCC)c1csc(C)n1 |
| InChI | InChI=1S/C9H14N2S/c1-4-8(10-5-2)9-6-12-7(3)11-9/h4,6,8,10H,1,5H2,2-3H3 |
| InChIKey | GYJYWGWSTFTZPY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|