About (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium
(1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium (PubChem CID 10516158) has the molecular formula C12H10F3N2O2+
and a molecular weight of 271.22 g/mol. Its IUPAC name is (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium.
Molecular Properties
| Compound Name | (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium |
| PubChem CID | 10516158 |
| Molecular Formula | C12H10F3N2O2+ |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium |
| SMILES | CO/C(O)=C(\C=C\c1ccc(C(F)(F)F)cc1)[N+]#N |
| InChI | InChI=1S/C12H9F3N2O2/c1-19-11(18)10(17-16)7-4-8-2-5-9(6-3-8)12(13,14)15/h2-7H,1H3/p+1/b7-4+,11-10+ |
| InChIKey | GQNLSKOXWLGNOG-QPABKMLOSA-O |
| XLogP | 3.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium?
The IUPAC name of (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium (CID 10516158) is (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium.
What is the SMILES notation for (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium?
The canonical SMILES for (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium is CO/C(O)=C(\C=C\c1ccc(C(F)(F)F)cc1)[N+]#N.
What is the InChIKey of (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium?
The InChIKey is GQNLSKOXWLGNOG-QPABKMLOSA-O. The full InChI is InChI=1S/C12H9F3N2O2/c1-19-11(18)10(17-16)7-4-8-2-5-9(6-3-8)12(13,14)15/h2-7H,1H3/p+1/b7-4+,11-10+.
What are the key properties of (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium?
(1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium has a molecular weight of 271.22 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3E)-1-hydroxy-1-methoxy-4-[4-(trifluoromethyl)phenyl]buta-1,3-diene-2-diazonium is sourced from PubChem (CID 10516158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).