C17H19N3S — CID 105161984
N-[(5-methylthiophen-2-yl)-quinoxalin-5-ylmethyl]propan-1-amine (PubChem CID 105161984) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)-quinoxalin-5-ylmethyl]propan-1-amine.
| Compound Name | N-[(5-methylthiophen-2-yl)-quinoxalin-5-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 105161984 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)-quinoxalin-5-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(C)s1)c1cccc2nccnc12 |
| InChI | InChI=1S/C17H19N3S/c1-3-9-19-17(15-8-7-12(2)21-15)13-5-4-6-14-16(13)20-11-10-18-14/h4-8,10-11,17,19H,3,9H2,1-2H3 |
| InChIKey | COHJYKCHADJNLZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |