C15H14BrNOS — CID 105162184
1-(7-bromo-1-benzofuran-2-yl)-N-methyl-1-(5-methylthiophen-2-yl)methanamine (PubChem CID 105162184) has the molecular formula C15H14BrNOS and a molecular weight of 336.25 g/mol. Its IUPAC name is 1-(7-bromo-1-benzofuran-2-yl)-N-methyl-1-(5-methylthiophen-2-yl)methanamine.
| Compound Name | 1-(7-bromo-1-benzofuran-2-yl)-N-methyl-1-(5-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 105162184 |
| Molecular Formula | C15H14BrNOS |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 1-(7-bromo-1-benzofuran-2-yl)-N-methyl-1-(5-methylthiophen-2-yl)methanamine |
| SMILES | CNC(c1cc2cccc(Br)c2o1)c1ccc(C)s1 |
| InChI | InChI=1S/C15H14BrNOS/c1-9-6-7-13(19-9)14(17-2)12-8-10-4-3-5-11(16)15(10)18-12/h3-8,14,17H,1-2H3 |
| InChIKey | GRPVWJHCNXEFAI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |