C16H18FN3S — CID 105162326
2-(2-ethyl-5-methylpyrazol-3-yl)-1-(5-fluoro-1-benzothiophen-2-yl)ethanamine (PubChem CID 105162326) has the molecular formula C16H18FN3S and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-(2-ethyl-5-methylpyrazol-3-yl)-1-(5-fluoro-1-benzothiophen-2-yl)ethanamine.
| Compound Name | 2-(2-ethyl-5-methylpyrazol-3-yl)-1-(5-fluoro-1-benzothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 105162326 |
| Molecular Formula | C16H18FN3S |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-(2-ethyl-5-methylpyrazol-3-yl)-1-(5-fluoro-1-benzothiophen-2-yl)ethanamine |
| SMILES | CCn1nc(C)cc1CC(N)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C16H18FN3S/c1-3-20-13(6-10(2)19-20)9-14(18)16-8-11-7-12(17)4-5-15(11)21-16/h4-8,14H,3,9,18H2,1-2H3 |
| InChIKey | PPUKSWVJCZAXGK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |