About 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine
3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine (PubChem CID 105163358) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine.
Molecular Properties
| Compound Name | 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine |
| PubChem CID | 105163358 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine |
| SMILES | CC(C)=CC(N)c1cnsn1 |
| InChI | InChI=1S/C7H11N3S/c1-5(2)3-6(8)7-4-9-11-10-7/h3-4,6H,8H2,1-2H3 |
| InChIKey | MHJPPITXVCVIIY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine?
The IUPAC name of 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine (CID 105163358) is 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine.
What is the SMILES notation for 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine?
The canonical SMILES for 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine is CC(C)=CC(N)c1cnsn1.
What is the InChIKey of 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine?
The InChIKey is MHJPPITXVCVIIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S/c1-5(2)3-6(8)7-4-9-11-10-7/h3-4,6H,8H2,1-2H3.
What are the key properties of 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine?
3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine has a molecular weight of 169.25 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(1,2,5-thiadiazol-3-yl)but-2-en-1-amine is sourced from PubChem (CID 105163358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).