C14H16N4S — CID 10516340
8-(4-methylpiperazin-1-yl)-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 10516340) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 8-(4-methylpiperazin-1-yl)-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 8-(4-methylpiperazin-1-yl)-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 10516340 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 8-(4-methylpiperazin-1-yl)-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | CN1CCN(c2nc3ccsc3n3cccc23)CC1 |
| InChI | InChI=1S/C14H16N4S/c1-16-6-8-17(9-7-16)13-12-3-2-5-18(12)14-11(15-13)4-10-19-14/h2-5,10H,6-9H2,1H3 |
| InChIKey | OYQJNUJWLVFCPE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |