About 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione
2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione (PubChem CID 10516350) has the molecular formula C13H28O2Si2
and a molecular weight of 272.54 g/mol. Its IUPAC name is 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione.
Molecular Properties
| Compound Name | 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione |
| PubChem CID | 10516350 |
| Molecular Formula | C13H28O2Si2 |
| Molecular Weight | 272.54 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione |
| SMILES | CC(CCCC(=O)[Si](C)(C)C)C(=O)[Si](C)(C)C |
| InChI | InChI=1S/C13H28O2Si2/c1-11(13(15)17(5,6)7)9-8-10-12(14)16(2,3)4/h11H,8-10H2,1-7H3 |
| InChIKey | JIJTVQKGMXJFSL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione?
The IUPAC name of 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione (CID 10516350) is 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione.
What is the SMILES notation for 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione?
The canonical SMILES for 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione is CC(CCCC(=O)[Si](C)(C)C)C(=O)[Si](C)(C)C.
What is the InChIKey of 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione?
The InChIKey is JIJTVQKGMXJFSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2Si2/c1-11(13(15)17(5,6)7)9-8-10-12(14)16(2,3)4/h11H,8-10H2,1-7H3.
What are the key properties of 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione?
2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione has a molecular weight of 272.54 g/mol, XLogP of 3.69, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,6-bis(trimethylsilyl)hexane-1,6-dione is sourced from PubChem (CID 10516350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).