About 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine
1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine (PubChem CID 105163620) has the molecular formula C12H21F2N
and a molecular weight of 217.30 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine |
| PubChem CID | 105163620 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)C(NCC)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H21F2N/c1-4-15-11(9(2)3)10-5-7-12(13,14)8-6-10/h10-11,15H,2,4-8H2,1,3H3 |
| InChIKey | QZNOZKHXQDFILA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine?
The IUPAC name of 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine (CID 105163620) is 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine.
What is the SMILES notation for 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine?
The canonical SMILES for 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine is C=C(C)C(NCC)C1CCC(F)(F)CC1.
What is the InChIKey of 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine?
The InChIKey is QZNOZKHXQDFILA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2N/c1-4-15-11(9(2)3)10-5-7-12(13,14)8-6-10/h10-11,15H,2,4-8H2,1,3H3.
What are the key properties of 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine?
1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine has a molecular weight of 217.30 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluorocyclohexyl)-N-ethyl-2-methylprop-2-en-1-amine is sourced from PubChem (CID 105163620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).