C13H16ClN3OS — CID 105164481
1-(4-chloro-3-methoxyphenyl)-1-(4-ethylthiadiazol-5-yl)-N-methylmethanamine (PubChem CID 105164481) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-1-(4-ethylthiadiazol-5-yl)-N-methylmethanamine.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-1-(4-ethylthiadiazol-5-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105164481 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-1-(4-ethylthiadiazol-5-yl)-N-methylmethanamine |
| SMILES | CCc1nnsc1C(NC)c1ccc(Cl)c(OC)c1 |
| InChI | InChI=1S/C13H16ClN3OS/c1-4-10-13(19-17-16-10)12(15-2)8-5-6-9(14)11(7-8)18-3/h5-7,12,15H,4H2,1-3H3 |
| InChIKey | KCIAGGFIAWZMQN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |