C17H22O3 — CID 10516460
[(1R,3S,8aR)-5,8a-dimethyl-6-oxo-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl] acetate (PubChem CID 10516460) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(1R,3S,8aR)-5,8a-dimethyl-6-oxo-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl] acetate.
| Compound Name | [(1R,3S,8aR)-5,8a-dimethyl-6-oxo-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 10516460 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(1R,3S,8aR)-5,8a-dimethyl-6-oxo-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl] acetate |
| SMILES | C=C(C)[C@H]1CC2=C(C)C(=O)C=C[C@@]2(C)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C17H22O3/c1-10(2)13-8-14-11(3)15(19)6-7-17(14,5)16(9-13)20-12(4)18/h6-7,13,16H,1,8-9H2,2-5H3/t13-,16+,17+/m0/s1 |
| InChIKey | JELSLYVHHUYBNO-IAOVAPTHSA-N |
| XLogP | 3.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|