C13H15N5S — CID 105164915
N-methyl-2-(1-methylbenzimidazol-2-yl)-1-(thiadiazol-5-yl)ethanamine (PubChem CID 105164915) has the molecular formula C13H15N5S and a molecular weight of 273.37 g/mol. Its IUPAC name is N-methyl-2-(1-methylbenzimidazol-2-yl)-1-(thiadiazol-5-yl)ethanamine.
| Compound Name | N-methyl-2-(1-methylbenzimidazol-2-yl)-1-(thiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105164915 |
| Molecular Formula | C13H15N5S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-methyl-2-(1-methylbenzimidazol-2-yl)-1-(thiadiazol-5-yl)ethanamine |
| SMILES | CNC(Cc1nc2ccccc2n1C)c1cnns1 |
| InChI | InChI=1S/C13H15N5S/c1-14-10(12-8-15-17-19-12)7-13-16-9-5-3-4-6-11(9)18(13)2/h3-6,8,10,14H,7H2,1-2H3 |
| InChIKey | JJRAPFGZRXYQOD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |