C14H21N5O — CID 10516542
(E,2S,3R)-3-(6-aminopurin-9-yl)non-5-en-2-ol (PubChem CID 10516542) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is (E,2S,3R)-3-(6-aminopurin-9-yl)non-5-en-2-ol.
| Compound Name | (E,2S,3R)-3-(6-aminopurin-9-yl)non-5-en-2-ol |
|---|---|
| PubChem CID | 10516542 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (E,2S,3R)-3-(6-aminopurin-9-yl)non-5-en-2-ol |
| SMILES | CCC/C=C/C[C@H]([C@H](C)O)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H21N5O/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19/h5-6,8-11,20H,3-4,7H2,1-2H3,(H2,15,16,17)/b6-5+/t10-,11+/m0/s1 |
| InChIKey | QZMKAUPEGUOLDB-PFDYWKIBSA-N |
| XLogP | 2.08 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|