C18H12O3 — CID 10516581
(3R,5S,6R,7S)-4-oxahexacyclo[9.8.0.02,8.03,5.03,18.014,19]nonadeca-1(11),2(8),9,12,14(19),15,17-heptaene-6,7-diol (PubChem CID 10516581) has the molecular formula C18H12O3 and a molecular weight of 276.29 g/mol. Its IUPAC name is (3R,5S,6R,7S)-4-oxahexacyclo[9.8.0.02,8.03,5.03,18.014,19]nonadeca-1(11),2(8),9,12,14(19),15,17-heptaene-6,7-diol.
| Compound Name | (3R,5S,6R,7S)-4-oxahexacyclo[9.8.0.02,8.03,5.03,18.014,19]nonadeca-1(11),2(8),9,12,14(19),15,17-heptaene-6,7-diol |
|---|---|
| PubChem CID | 10516581 |
| Molecular Formula | C18H12O3 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (3R,5S,6R,7S)-4-oxahexacyclo[9.8.0.02,8.03,5.03,18.014,19]nonadeca-1(11),2(8),9,12,14(19),15,17-heptaene-6,7-diol |
| SMILES | O[C@@H]1[C@@H](O)c2ccc3ccc4cccc5c4c3c2[C@]52O[C@@H]12 |
| InChI | InChI=1S/C18H12O3/c19-15-10-7-6-9-5-4-8-2-1-3-11-12(8)13(9)14(10)18(11)17(21-18)16(15)20/h1-7,15-17,19-20H/t15-,16+,17-,18+/m0/s1 |
| InChIKey | WYKYLTFPDQSTEC-XWTMOSNGSA-N |
| XLogP | 2.36 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|