C17H26N4 — CID 105167752
N,N-dimethyl-4-[1-(methylamino)-2-(1-propylimidazol-2-yl)ethyl]aniline (PubChem CID 105167752) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-(methylamino)-2-(1-propylimidazol-2-yl)ethyl]aniline.
| Compound Name | N,N-dimethyl-4-[1-(methylamino)-2-(1-propylimidazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 105167752 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N,N-dimethyl-4-[1-(methylamino)-2-(1-propylimidazol-2-yl)ethyl]aniline |
| SMILES | CCCn1ccnc1CC(NC)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H26N4/c1-5-11-21-12-10-19-17(21)13-16(18-2)14-6-8-15(9-7-14)20(3)4/h6-10,12,16,18H,5,11,13H2,1-4H3 |
| InChIKey | FTTIEEBEIJXAFK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|