About (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol
(2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol (PubChem CID 10516818) has the molecular formula C19H21NO
and a molecular weight of 279.38 g/mol. Its IUPAC name is (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 10516818 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol |
| SMILES | C=CCN(C)[C@@H]1Cc2ccc(O)cc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21NO/c1-3-11-20(2)18-12-15-9-10-16(21)13-17(15)19(18)14-7-5-4-6-8-14/h3-10,13,18-19,21H,1,11-12H2,2H3/t18-,19-/m1/s1 |
| InChIKey | XWQIFHFKVSCKAY-RTBURBONSA-N |
| XLogP | 3.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol (CID 10516818) is (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol is C=CCN(C)[C@@H]1Cc2ccc(O)cc2[C@H]1c1ccccc1.
What is the InChIKey of (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol?
The InChIKey is XWQIFHFKVSCKAY-RTBURBONSA-N. The full InChI is InChI=1S/C19H21NO/c1-3-11-20(2)18-12-15-9-10-16(21)13-17(15)19(18)14-7-5-4-6-8-14/h3-10,13,18-19,21H,1,11-12H2,2H3/t18-,19-/m1/s1.
What are the key properties of (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol?
(2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol has a molecular weight of 279.38 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-[methyl(prop-2-enyl)amino]-3-phenyl-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 10516818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).