C14H18O6 — CID 10516994
[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2-phenylacetate (PubChem CID 10516994) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2-phenylacetate.
| Compound Name | [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 10516994 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2-phenylacetate |
| SMILES | C[C@@H]1O[C@@H](OC(=O)Cc2ccccc2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H18O6/c1-8-11(16)12(17)13(18)14(19-8)20-10(15)7-9-5-3-2-4-6-9/h2-6,8,11-14,16-18H,7H2,1H3/t8-,11-,12+,13+,14-/m0/s1 |
| InChIKey | HHIYFURVKQDJLD-CNJBRALLSA-N |
| XLogP | -0.40 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |