About 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate
3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate (PubChem CID 10517029) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate.
Molecular Properties
| Compound Name | 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate |
| PubChem CID | 10517029 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate |
| SMILES | CC(=O)OCCCC1=C(C)C[C@@H](OC(C)=O)CC1(C)C |
| InChI | InChI=1S/C16H26O4/c1-11-9-14(20-13(3)18)10-16(4,5)15(11)7-6-8-19-12(2)17/h14H,6-10H2,1-5H3/t14-/m1/s1 |
| InChIKey | GKHNQUAJIVNCIO-CQSZACIVSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate?
The IUPAC name of 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate (CID 10517029) is 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate.
What is the SMILES notation for 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate?
The canonical SMILES for 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate is CC(=O)OCCCC1=C(C)C[C@@H](OC(C)=O)CC1(C)C.
What is the InChIKey of 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate?
The InChIKey is GKHNQUAJIVNCIO-CQSZACIVSA-N. The full InChI is InChI=1S/C16H26O4/c1-11-9-14(20-13(3)18)10-16(4,5)15(11)7-6-8-19-12(2)17/h14H,6-10H2,1-5H3/t14-/m1/s1.
What are the key properties of 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate?
3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate has a molecular weight of 282.38 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4R)-4-acetyloxy-2,6,6-trimethylcyclohexen-1-yl]propyl acetate is sourced from PubChem (CID 10517029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).